C24H32O6 — CID 86576126
(2S,3S,4R,5R)-2-(3,4-dimethoxy-5-methylphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 86576126) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3,4-dimethoxy-5-methylphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | (2S,3S,4R,5R)-2-(3,4-dimethoxy-5-methylphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 86576126 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3,4-dimethoxy-5-methylphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | COc1cc([C@H]2O[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@H](C)[C@@H]2C)cc(C)c1OC |
| InChI | InChI=1S/C24H32O6/c1-13-9-16(10-18(25-4)21(13)28-7)22-14(2)15(3)23(30-22)17-11-19(26-5)24(29-8)20(12-17)27-6/h9-12,14-15,22-23H,1-8H3/t14-,15+,22-,23+/m0/s1 |
| InChIKey | MCHZHRAQUKACRL-JEJQNCNXSA-N |
| XLogP | 5.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |