C21H32O5 — CID 123967052
[5-(3,4-dimethoxy-5-methylphenyl)-2-methoxy-3,4,6-trimethylcyclohexyl]methyl formate (PubChem CID 123967052) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [5-(3,4-dimethoxy-5-methylphenyl)-2-methoxy-3,4,6-trimethylcyclohexyl]methyl formate.
| Compound Name | [5-(3,4-dimethoxy-5-methylphenyl)-2-methoxy-3,4,6-trimethylcyclohexyl]methyl formate |
|---|---|
| PubChem CID | 123967052 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [5-(3,4-dimethoxy-5-methylphenyl)-2-methoxy-3,4,6-trimethylcyclohexyl]methyl formate |
| SMILES | COc1cc(C2C(C)C(C)C(OC)C(COC=O)C2C)cc(C)c1OC |
| InChI | InChI=1S/C21H32O5/c1-12-8-16(9-18(23-5)20(12)24-6)19-13(2)14(3)21(25-7)17(15(19)4)10-26-11-22/h8-9,11,13-15,17,19,21H,10H2,1-7H3 |
| InChIKey | WVWXWMZHVXMYRT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|