C25H30O6 — CID 51666253
4-[(3S,3aS,6R,6aR)-6-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol (PubChem CID 51666253) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 4-[(3S,3aS,6R,6aR)-6-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol.
| Compound Name | 4-[(3S,3aS,6R,6aR)-6-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 51666253 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 4-[(3S,3aS,6R,6aR)-6-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| SMILES | COc1cc([C@H]2OC[C@H]3[C@H]2CO[C@H]3c2ccc(OCC=C(C)C)c(OC)c2)ccc1O |
| InChI | InChI=1S/C25H30O6/c1-15(2)9-10-29-21-8-6-17(12-23(21)28-4)25-19-14-30-24(18(19)13-31-25)16-5-7-20(26)22(11-16)27-3/h5-9,11-12,18-19,24-26H,10,13-14H2,1-4H3/t18-,19+,24-,25+/m1/s1 |
| InChIKey | AEUNPKMMYWMUQF-VCWUMBODSA-N |
| XLogP | 4.83 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|