C15H11ClO2S — CID 10541561
3-(4-chlorophenyl)-2,3-dihydro-4,1-benzoxathiepin-5-one (PubChem CID 10541561) has the molecular formula C15H11ClO2S and a molecular weight of 290.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,3-dihydro-4,1-benzoxathiepin-5-one.
| Compound Name | 3-(4-chlorophenyl)-2,3-dihydro-4,1-benzoxathiepin-5-one |
|---|---|
| PubChem CID | 10541561 |
| Molecular Formula | C15H11ClO2S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-(4-chlorophenyl)-2,3-dihydro-4,1-benzoxathiepin-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)CSc2ccccc21 |
| InChI | InChI=1S/C15H11ClO2S/c16-11-7-5-10(6-8-11)13-9-19-14-4-2-1-3-12(14)15(17)18-13/h1-8,13H,9H2 |
| InChIKey | NUZUYPPTMWYEOS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |