C11H14N2O2 — CID 82236769
3-(2-hydroxyethylamino)-1-methyl-3H-indol-2-one (PubChem CID 82236769) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)-1-methyl-3H-indol-2-one.
| Compound Name | 3-(2-hydroxyethylamino)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 82236769 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-(2-hydroxyethylamino)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)C(NCCO)c2ccccc21 |
| InChI | InChI=1S/C11H14N2O2/c1-13-9-5-3-2-4-8(9)10(11(13)15)12-6-7-14/h2-5,10,12,14H,6-7H2,1H3 |
| InChIKey | XIGNPPGJPIFHCN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |