C19H27N5O3 — CID 98231836
N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide (PubChem CID 98231836) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide.
| Compound Name | N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 98231836 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide |
| SMILES | CN1CCN(CCCNC(=O)C(=O)N[C@H]2C(=O)N(C)c3ccccc32)CC1 |
| InChI | InChI=1S/C19H27N5O3/c1-22-10-12-24(13-11-22)9-5-8-20-17(25)18(26)21-16-14-6-3-4-7-15(14)23(2)19(16)27/h3-4,6-7,16H,5,8-13H2,1-2H3,(H,20,25)(H,21,26)/t16-/m1/s1 |
| InChIKey | IMXZXBNPQHUOBF-MRXNPFEDSA-N |
| XLogP | -0.43 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|