C21H23N3O3 — CID 51972137
N-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]-N'-[(2R)-4-phenylbutan-2-yl]oxamide (PubChem CID 51972137) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]-N'-[(2R)-4-phenylbutan-2-yl]oxamide.
| Compound Name | N-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]-N'-[(2R)-4-phenylbutan-2-yl]oxamide |
|---|---|
| PubChem CID | 51972137 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]-N'-[(2R)-4-phenylbutan-2-yl]oxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)C(=O)N[C@@H]1C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O3/c1-14(12-13-15-8-4-3-5-9-15)22-19(25)20(26)23-18-16-10-6-7-11-17(16)24(2)21(18)27/h3-11,14,18H,12-13H2,1-2H3,(H,22,25)(H,23,26)/t14-,18+/m1/s1 |
| InChIKey | CGQSRUHKPFAXCF-KDOFPFPSSA-N |
| XLogP | 1.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|