C18H26N4O3 — CID 40947557
N-[3-(diethylamino)propyl]-N'-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]oxamide (PubChem CID 40947557) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N'-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]oxamide.
| Compound Name | N-[3-(diethylamino)propyl]-N'-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
|---|---|
| PubChem CID | 40947557 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N'-[(3S)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
| SMILES | CCN(CC)CCCNC(=O)C(=O)N[C@@H]1C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C18H26N4O3/c1-4-22(5-2)12-8-11-19-16(23)17(24)20-15-13-9-6-7-10-14(13)21(3)18(15)25/h6-7,9-10,15H,4-5,8,11-12H2,1-3H3,(H,19,23)(H,20,24)/t15-/m0/s1 |
| InChIKey | SBEIXBJVPHVSQM-HNNXBMFYSA-N |
| XLogP | 0.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|