C21H19FN4O3 — CID 41025250
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide (PubChem CID 41025250) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
|---|---|
| PubChem CID | 41025250 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)C(=O)NCCc2c[nH]c3ccc(F)cc23)c2ccccc21 |
| InChI | InChI=1S/C21H19FN4O3/c1-26-17-5-3-2-4-14(17)18(21(26)29)25-20(28)19(27)23-9-8-12-11-24-16-7-6-13(22)10-15(12)16/h2-7,10-11,18,24H,8-9H2,1H3,(H,23,27)(H,25,28)/t18-/m1/s1 |
| InChIKey | GERVYMIFEXKCGI-GOSISDBHSA-N |
| XLogP | 1.80 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|