C18H19NO — CID 706826
(4aR,12cR)-4a-methyl-1,2,3,4,5,12c-hexahydrobenzo[k]phenanthridin-6-one (PubChem CID 706826) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (4aR,12cR)-4a-methyl-1,2,3,4,5,12c-hexahydrobenzo[k]phenanthridin-6-one.
| Compound Name | (4aR,12cR)-4a-methyl-1,2,3,4,5,12c-hexahydrobenzo[k]phenanthridin-6-one |
|---|---|
| PubChem CID | 706826 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4aR,12cR)-4a-methyl-1,2,3,4,5,12c-hexahydrobenzo[k]phenanthridin-6-one |
| SMILES | C[C@@]12CCCC[C@@H]1c1c(ccc3ccccc13)C(=O)N2 |
| InChI | InChI=1S/C18H19NO/c1-18-11-5-4-8-15(18)16-13-7-3-2-6-12(13)9-10-14(16)17(20)19-18/h2-3,6-7,9-10,15H,4-5,8,11H2,1H3,(H,19,20)/t15-,18-/m1/s1 |
| InChIKey | WATQVSNWFYICCW-CRAIPNDOSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |