C13H10N2O2 — CID 11117738
3,4-dihydro-1H-benzo[i][1,4]benzodiazepine-2,5-dione (PubChem CID 11117738) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3,4-dihydro-1H-benzo[i][1,4]benzodiazepine-2,5-dione.
| Compound Name | 3,4-dihydro-1H-benzo[i][1,4]benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 11117738 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3,4-dihydro-1H-benzo[i][1,4]benzodiazepine-2,5-dione |
| SMILES | O=C1CNC(=O)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C13H10N2O2/c16-11-7-14-13(17)10-6-5-8-3-1-2-4-9(8)12(10)15-11/h1-6H,7H2,(H,14,17)(H,15,16) |
| InChIKey | YEGNVXFAMUZUFX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |