C17H13N — CID 165358005
5,6-dihydrobenzo[i]phenanthridine (PubChem CID 165358005) has the molecular formula C17H13N and a molecular weight of 231.30 g/mol. Its IUPAC name is 5,6-dihydrobenzo[i]phenanthridine.
| Compound Name | 5,6-dihydrobenzo[i]phenanthridine |
|---|---|
| PubChem CID | 165358005 |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5,6-dihydrobenzo[i]phenanthridine |
| SMILES | c1ccc2c(c1)NCc1c-2ccc2ccccc12 |
| InChI | InChI=1S/C17H13N/c1-2-6-13-12(5-1)9-10-14-15-7-3-4-8-17(15)18-11-16(13)14/h1-10,18H,11H2 |
| InChIKey | AQULYNXNBQEPSG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |