C16H11N — CID 154087157
13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 154087157) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is 13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 154087157 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | c1ccc2c3c(ccc2c1)-c1cnccc1C3 |
| InChI | InChI=1S/C16H11N/c1-2-4-13-11(3-1)5-6-14-15(13)9-12-7-8-17-10-16(12)14/h1-8,10H,9H2 |
| InChIKey | AJDMRZYTDUHZFT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |