C37H24 — CID 161215965
11H-benzo[a]fluorene;indeno[2,1-a]fluorene (PubChem CID 161215965) has the molecular formula C37H24 and a molecular weight of 468.60 g/mol. Its IUPAC name is 11H-benzo[a]fluorene;indeno[2,1-a]fluorene.
| Compound Name | 11H-benzo[a]fluorene;indeno[2,1-a]fluorene |
|---|---|
| PubChem CID | 161215965 |
| Molecular Formula | C37H24 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 11H-benzo[a]fluorene;indeno[2,1-a]fluorene |
| SMILES | C1=c2c(ccc3c2=Cc2ccccc2-3)-c2ccccc21.c1ccc2c(c1)Cc1c-2ccc2ccccc12 |
| InChI | InChI=1S/C20H12.C17H12/c1-3-7-15-13(5-1)11-19-17(15)9-10-18-16-8-4-2-6-14(16)12-20(18)19;1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-12H;1-10H,11H2 |
| InChIKey | UWWFPDZLJWNMJU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |