About 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane]
1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] (PubChem CID 3123749) has the molecular formula C19H23N
and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane].
Molecular Properties
| Compound Name | 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] |
| PubChem CID | 3123749 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] |
| SMILES | CC1CC2(CCCCC2)Nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C19H23N/c1-14-13-19(11-5-2-6-12-19)20-17-10-9-15-7-3-4-8-16(15)18(14)17/h3-4,7-10,14,20H,2,5-6,11-13H2,1H3 |
| InChIKey | UJJHDDJMKONPHZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane]?
The IUPAC name of 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] (CID 3123749) is 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane].
What is the SMILES notation for 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane]?
The canonical SMILES for 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] is CC1CC2(CCCCC2)Nc2ccc3ccccc3c21.
What is the InChIKey of 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane]?
The InChIKey is UJJHDDJMKONPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N/c1-14-13-19(11-5-2-6-12-19)20-17-10-9-15-7-3-4-8-16(15)18(14)17/h3-4,7-10,14,20H,2,5-6,11-13H2,1H3.
What are the key properties of 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane]?
1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] has a molecular weight of 265.40 g/mol, XLogP of 5.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[2,4-dihydro-1H-benzo[f]quinoline-3,1'-cyclohexane] is sourced from PubChem (CID 3123749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).