C16H20N2O2 — CID 6926116
2-[[(4aS,10bR)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene]azaniumyl]acetate (PubChem CID 6926116) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[[(4aS,10bR)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene]azaniumyl]acetate.
| Compound Name | 2-[[(4aS,10bR)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene]azaniumyl]acetate |
|---|---|
| PubChem CID | 6926116 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[[(4aS,10bR)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene]azaniumyl]acetate |
| SMILES | C[C@]12CCCC[C@@H]1c1ccccc1/C(=[NH+]/CC(=O)[O-])N2 |
| InChI | InChI=1S/C16H20N2O2/c1-16-9-5-4-8-13(16)11-6-2-3-7-12(11)15(18-16)17-10-14(19)20/h2-3,6-7,13H,4-5,8-10H2,1H3,(H,17,18)(H,19,20)/t13-,16+/m1/s1 |
| InChIKey | WULCKMSMQDDXRS-CJNGLKHVSA-N |
| XLogP | -0.72 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|