C19H20O — CID 10515771
2-(9H-fluoren-9-yl)-1-methylcyclopentan-1-ol (PubChem CID 10515771) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)-1-methylcyclopentan-1-ol.
| Compound Name | 2-(9H-fluoren-9-yl)-1-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 10515771 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(9H-fluoren-9-yl)-1-methylcyclopentan-1-ol |
| SMILES | CC1(O)CCCC1C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H20O/c1-19(20)12-6-11-17(19)18-15-9-4-2-7-13(15)14-8-3-5-10-16(14)18/h2-5,7-10,17-18,20H,6,11-12H2,1H3 |
| InChIKey | QQHQZQBJDQGESU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |