C20H24N+ — CID 8000708
9H-fluoren-9-yl-[(1S,2S)-2-methylcyclohexyl]azanium (PubChem CID 8000708) has the molecular formula C20H24N+ and a molecular weight of 278.42 g/mol. Its IUPAC name is 9H-fluoren-9-yl-[(1S,2S)-2-methylcyclohexyl]azanium.
| Compound Name | 9H-fluoren-9-yl-[(1S,2S)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 8000708 |
| Molecular Formula | C20H24N+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 9H-fluoren-9-yl-[(1S,2S)-2-methylcyclohexyl]azanium |
| SMILES | C[C@H]1CCCC[C@@H]1[NH2+]C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H23N/c1-14-8-2-7-13-19(14)21-20-17-11-5-3-9-15(17)16-10-4-6-12-18(16)20/h3-6,9-12,14,19-21H,2,7-8,13H2,1H3/p+1/t14-,19-/m0/s1 |
| InChIKey | MKQHVISXGKCEAB-LIRRHRJNSA-O |
| XLogP | 3.90 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |