C21H27N2O+ — CID 6951801
[(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 6951801) has the molecular formula C21H27N2O+ and a molecular weight of 323.46 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 6951801 |
| Molecular Formula | C21H27N2O+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | C[C@H]1CCCC[C@@H]1[NH2+]CC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-16-9-5-7-13-19(16)22-15-21(24)23-20-14-8-6-12-18(20)17-10-3-2-4-11-17/h2-4,6,8,10-12,14,16,19,22H,5,7,9,13,15H2,1H3,(H,23,24)/p+1/t16-,19-/m0/s1 |
| InChIKey | LEMNCDPTRIEGFF-LPHOPBHVSA-O |
| XLogP | 3.43 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |