C20H32N3O+ — CID 7406995
[(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-piperidin-1-ylanilino)ethyl]azanium (PubChem CID 7406995) has the molecular formula C20H32N3O+ and a molecular weight of 330.50 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-piperidin-1-ylanilino)ethyl]azanium.
| Compound Name | [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-piperidin-1-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 7406995 |
| Molecular Formula | C20H32N3O+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | [(1S,2S)-2-methylcyclohexyl]-[2-oxo-2-(2-piperidin-1-ylanilino)ethyl]azanium |
| SMILES | C[C@H]1CCCC[C@@H]1[NH2+]CC(=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C20H31N3O/c1-16-9-3-4-10-17(16)21-15-20(24)22-18-11-5-6-12-19(18)23-13-7-2-8-14-23/h5-6,11-12,16-17,21H,2-4,7-10,13-15H2,1H3,(H,22,24)/p+1/t16-,17-/m0/s1 |
| InChIKey | XOWWJJUWINRWDK-IRXDYDNUSA-O |
| XLogP | 2.76 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |