C22H29N2O+ — CID 11939600
[(1R,2R,3R)-2,3-dimethylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 11939600) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is [(1R,2R,3R)-2,3-dimethylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | [(1R,2R,3R)-2,3-dimethylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 11939600 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [(1R,2R,3R)-2,3-dimethylcyclohexyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1[NH2+]CC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-16-9-8-14-20(17(16)2)23-15-22(25)24-21-13-7-6-12-19(21)18-10-4-3-5-11-18/h3-7,10-13,16-17,20,23H,8-9,14-15H2,1-2H3,(H,24,25)/p+1/t16-,17-,20-/m1/s1 |
| InChIKey | XRZYCRAKMZTCBR-MBOZVWFJSA-O |
| XLogP | 3.68 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |