C14H20O3 — CID 10561805
cis-(1S,6S)-1-(2-hydroxyethyl)-6-phenylcyclohexane-1,2-diol (PubChem CID 10561805) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is cis-(1S,6S)-1-(2-hydroxyethyl)-6-phenylcyclohexane-1,2-diol.
| Compound Name | cis-(1S,6S)-1-(2-hydroxyethyl)-6-phenylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 10561805 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | cis-(1S,6S)-1-(2-hydroxyethyl)-6-phenylcyclohexane-1,2-diol |
| SMILES | OCC[C@@]1(O)C(O)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H20O3/c15-10-9-14(17)12(7-4-8-13(14)16)11-5-2-1-3-6-11/h1-3,5-6,12-13,15-17H,4,7-10H2/t12-,13?,14-/m0/s1 |
| InChIKey | BYAIIQUTFMUHDH-HPNRGHHYSA-N |
| XLogP | 1.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |