C16H18O4 — CID 56983279
(4aR,9S,10aS)-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid (PubChem CID 56983279) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (4aR,9S,10aS)-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid.
| Compound Name | (4aR,9S,10aS)-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid |
|---|---|
| PubChem CID | 56983279 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4aR,9S,10aS)-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H]2CCCC[C@]2(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H18O4/c17-14(18)12-9-10-5-3-4-8-16(10,15(19)20)13-7-2-1-6-11(12)13/h1-2,6-7,10,12H,3-5,8-9H2,(H,17,18)(H,19,20)/t10-,12-,16+/m0/s1 |
| InChIKey | QQWOERGEARQOKP-KNHMANMVSA-N |
| XLogP | 2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |