C16H18O2 — CID 125492834
(4aS,9R,10aS)-9-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-4a-carboxylic acid (PubChem CID 125492834) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (4aS,9R,10aS)-9-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-4a-carboxylic acid.
| Compound Name | (4aS,9R,10aS)-9-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-4a-carboxylic acid |
|---|---|
| PubChem CID | 125492834 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (4aS,9R,10aS)-9-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-4a-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H]2CC=CC[C@@]2(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H18O2/c1-11-10-12-6-4-5-9-16(12,15(17)18)14-8-3-2-7-13(11)14/h2-5,7-8,11-12H,6,9-10H2,1H3,(H,17,18)/t11-,12+,16+/m1/s1 |
| InChIKey | MMWQBKQRAOSCFA-WQGACYEGSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|