C20H20O6 — CID 174941478
1,2-bis(2-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid (PubChem CID 174941478) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is 1,2-bis(2-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 1,2-bis(2-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174941478 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1,2-bis(2-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
| SMILES | COc1ccccc1C1C(C(=O)O)CC1(C(=O)O)c1ccccc1OC |
| InChI | InChI=1S/C20H20O6/c1-25-15-9-5-3-7-12(15)17-13(18(21)22)11-20(17,19(23)24)14-8-4-6-10-16(14)26-2/h3-10,13,17H,11H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | YELSTFFSAOFIEM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |