C16H20O2S — CID 100975056
(1S,2R,4R)-2-(benzenesulfonyl)-2-ethyl-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 100975056) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is (1S,2R,4R)-2-(benzenesulfonyl)-2-ethyl-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R)-2-(benzenesulfonyl)-2-ethyl-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 100975056 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1S,2R,4R)-2-(benzenesulfonyl)-2-ethyl-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1[C@@H]2CC[C@@H](C2)[C@@]1(CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O2S/c1-3-16(12(2)13-9-10-14(16)11-13)19(17,18)15-7-5-4-6-8-15/h4-8,13-14H,2-3,9-11H2,1H3/t13-,14+,16+/m1/s1 |
| InChIKey | NDOHFGPETWWHTO-YCPHGPKFSA-N |
| XLogP | 3.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|