C16H19NO2 — CID 14068960
3-(2,2-dimethylpropyl)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 14068960) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(2,2-dimethylpropyl)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 14068960 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC(C)(C)CN1C(=O)C2CC2(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H19NO2/c1-15(2,3)10-17-13(18)12-9-16(12,14(17)19)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3 |
| InChIKey | WOHXKGHJJLXDKM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|