C14H11N3O3 — CID 66803821
3-benzyl-1-(oxadiazol-5-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 66803821) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-benzyl-1-(oxadiazol-5-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-benzyl-1-(oxadiazol-5-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 66803821 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-benzyl-1-(oxadiazol-5-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2(c2cnno2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H11N3O3/c18-12-10-6-14(10,11-7-15-16-20-11)13(19)17(12)8-9-4-2-1-3-5-9/h1-5,7,10H,6,8H2 |
| InChIKey | LFFRBIOCJPKSTD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|