C19H17NO3 — CID 102505304
(4R,8aR)-4,8a-diphenyl-3,4,7,8-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,6-dione (PubChem CID 102505304) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (4R,8aR)-4,8a-diphenyl-3,4,7,8-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,6-dione.
| Compound Name | (4R,8aR)-4,8a-diphenyl-3,4,7,8-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,6-dione |
|---|---|
| PubChem CID | 102505304 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4R,8aR)-4,8a-diphenyl-3,4,7,8-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,6-dione |
| SMILES | O=C1CC[C@@]2(c3ccccc3)C(=O)OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C19H17NO3/c21-17-11-12-19(15-9-5-2-6-10-15)18(22)23-13-16(20(17)19)14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-,19+/m0/s1 |
| InChIKey | BLPFHKURNPWRMI-QFBILLFUSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |