C25H23NO2 — CID 15362456
(3S,7aR)-7a-methyl-2,2,3-triphenyl-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 15362456) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3S,7aR)-7a-methyl-2,2,3-triphenyl-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3S,7aR)-7a-methyl-2,2,3-triphenyl-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 15362456 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3S,7aR)-7a-methyl-2,2,3-triphenyl-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](c1ccccc1)C(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C25H23NO2/c1-24-18-17-22(27)26(24)23(19-11-5-2-6-12-19)25(28-24,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,23H,17-18H2,1H3/t23-,24+/m0/s1 |
| InChIKey | KMZAJSGFGRJGBM-BJKOFHAPSA-N |
| XLogP | 5.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |