C22H24O3 — CID 2750548
5,7,7-trimethyl-4,4-diphenyl-3,6-dioxabicyclo[3.2.2]nonan-2-one (PubChem CID 2750548) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 5,7,7-trimethyl-4,4-diphenyl-3,6-dioxabicyclo[3.2.2]nonan-2-one.
| Compound Name | 5,7,7-trimethyl-4,4-diphenyl-3,6-dioxabicyclo[3.2.2]nonan-2-one |
|---|---|
| PubChem CID | 2750548 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 5,7,7-trimethyl-4,4-diphenyl-3,6-dioxabicyclo[3.2.2]nonan-2-one |
| SMILES | CC1(C)OC2(C)CCC1C(=O)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24O3/c1-20(2)18-14-15-21(3,25-20)22(24-19(18)23,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3 |
| InChIKey | HVDYOZGDLMDFIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |