C22H22F2O4 — CID 18756295
methyl 3-[bis(4-fluorophenyl)methoxy]-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 18756295) has the molecular formula C22H22F2O4 and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 3-[bis(4-fluorophenyl)methoxy]-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-[bis(4-fluorophenyl)methoxy]-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 18756295 |
| Molecular Formula | C22H22F2O4 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl 3-[bis(4-fluorophenyl)methoxy]-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(CC1OC(c1ccc(F)cc1)c1ccc(F)cc1)O2 |
| InChI | InChI=1S/C22H22F2O4/c1-26-22(25)20-18-11-10-17(27-18)12-19(20)28-21(13-2-6-15(23)7-3-13)14-4-8-16(24)9-5-14/h2-9,17-21H,10-12H2,1H3 |
| InChIKey | IXQQMWIAXLMOHP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |