C27H44O3Sn — CID 69023126
methyl 3-(4-tributylstannylphenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 69023126) has the molecular formula C27H44O3Sn and a molecular weight of 535.36 g/mol. Its IUPAC name is methyl 3-(4-tributylstannylphenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-(4-tributylstannylphenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 69023126 |
| Molecular Formula | C27H44O3Sn |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | methyl 3-(4-tributylstannylphenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C2CC3CCC(O3)C2C(=O)OC)cc1 |
| InChI | InChI=1S/C15H17O3.3C4H9.Sn/c1-17-15(16)14-12(10-5-3-2-4-6-10)9-11-7-8-13(14)18-11;3*1-3-4-2;/h3-6,11-14H,7-9H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | WBTJVPDCXUBVLO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |