C18H23FO3 — CID 123806945
methyl 2-(2-fluorophenyl)-1-oxaspiro[5.5]undecane-3-carboxylate (PubChem CID 123806945) has the molecular formula C18H23FO3 and a molecular weight of 306.38 g/mol. Its IUPAC name is methyl 2-(2-fluorophenyl)-1-oxaspiro[5.5]undecane-3-carboxylate.
| Compound Name | methyl 2-(2-fluorophenyl)-1-oxaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 123806945 |
| Molecular Formula | C18H23FO3 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl 2-(2-fluorophenyl)-1-oxaspiro[5.5]undecane-3-carboxylate |
| SMILES | COC(=O)C1CCC2(CCCCC2)OC1c1ccccc1F |
| InChI | InChI=1S/C18H23FO3/c1-21-17(20)14-9-12-18(10-5-2-6-11-18)22-16(14)13-7-3-4-8-15(13)19/h3-4,7-8,14,16H,2,5-6,9-12H2,1H3 |
| InChIKey | CBDIBSLXPWUHAB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |