C15H15FO4 — CID 149077637
methyl (2S,3R)-2-(2-fluorophenyl)-1,4-dioxaspiro[4.4]non-7-ene-3-carboxylate (PubChem CID 149077637) has the molecular formula C15H15FO4 and a molecular weight of 278.28 g/mol. Its IUPAC name is methyl (2S,3R)-2-(2-fluorophenyl)-1,4-dioxaspiro[4.4]non-7-ene-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-(2-fluorophenyl)-1,4-dioxaspiro[4.4]non-7-ene-3-carboxylate |
|---|---|
| PubChem CID | 149077637 |
| Molecular Formula | C15H15FO4 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methyl (2S,3R)-2-(2-fluorophenyl)-1,4-dioxaspiro[4.4]non-7-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1OC2(CC=CC2)O[C@H]1c1ccccc1F |
| InChI | InChI=1S/C15H15FO4/c1-18-14(17)13-12(10-6-2-3-7-11(10)16)19-15(20-13)8-4-5-9-15/h2-7,12-13H,8-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | QPKJEFXECFVLKP-QWHCGFSZSA-N |
| XLogP | 2.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|