C15H19FO2 — CID 150430231
(2R,3S)-3-(2-fluorophenyl)-2-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 150430231) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (2R,3S)-3-(2-fluorophenyl)-2-methyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (2R,3S)-3-(2-fluorophenyl)-2-methyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 150430231 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2R,3S)-3-(2-fluorophenyl)-2-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | C[C@H]1OC2(CCCCC2)O[C@H]1c1ccccc1F |
| InChI | InChI=1S/C15H19FO2/c1-11-14(12-7-3-4-8-13(12)16)18-15(17-11)9-5-2-6-10-15/h3-4,7-8,11,14H,2,5-6,9-10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | HJPZOJRTASMVBS-BXUZGUMPSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |