C24H21NO3 — CID 10499461
(1S,9S,10R)-1-methoxy-11-methyl-9,10-diphenyl-12-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 10499461) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (1S,9S,10R)-1-methoxy-11-methyl-9,10-diphenyl-12-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10R)-1-methoxy-11-methyl-9,10-diphenyl-12-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 10499461 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (1S,9S,10R)-1-methoxy-11-methyl-9,10-diphenyl-12-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CO[C@]12O[C@](c3ccccc3)(C(=O)c3ccccc31)[C@@H](c1ccccc1)N2C |
| InChI | InChI=1S/C24H21NO3/c1-25-21(17-11-5-3-6-12-17)23(18-13-7-4-8-14-18)22(26)19-15-9-10-16-20(19)24(25,27-2)28-23/h3-16,21H,1-2H3/t21-,23+,24+/m1/s1 |
| InChIKey | DAQLSYRIDCBQKF-NHTMILBNSA-N |
| XLogP | 4.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |