C32H35O3P — CID 10791470
(1S,9S,10R,11R)-10-tert-butyl-11-cyclohexyloxy-1,9-diphenyl-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 10791470) has the molecular formula C32H35O3P and a molecular weight of 498.60 g/mol. Its IUPAC name is (1S,9S,10R,11R)-10-tert-butyl-11-cyclohexyloxy-1,9-diphenyl-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10R,11R)-10-tert-butyl-11-cyclohexyloxy-1,9-diphenyl-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 10791470 |
| Molecular Formula | C32H35O3P |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (1S,9S,10R,11R)-10-tert-butyl-11-cyclohexyloxy-1,9-diphenyl-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CC(C)(C)[C@H]1[P@@](OC2CCCCC2)[C@]2(c3ccccc3)O[C@@]1(c1ccccc1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C32H35O3P/c1-30(2,3)29-31(23-15-7-4-8-16-23)28(33)26-21-13-14-22-27(26)32(35-31,24-17-9-5-10-18-24)36(29)34-25-19-11-6-12-20-25/h4-5,7-10,13-18,21-22,25,29H,6,11-12,19-20H2,1-3H3/t29-,31+,32+,36-/m1/s1 |
| InChIKey | ZJPVDFPIIKENNK-DLNVXIGSSA-N |
| XLogP | 8.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|