C29H31O3P — CID 10766306
(1S,9S,10R,11R)-10-tert-butyl-1,9-diphenyl-11-propoxy-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 10766306) has the molecular formula C29H31O3P and a molecular weight of 458.54 g/mol. Its IUPAC name is (1S,9S,10R,11R)-10-tert-butyl-1,9-diphenyl-11-propoxy-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10R,11R)-10-tert-butyl-1,9-diphenyl-11-propoxy-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 10766306 |
| Molecular Formula | C29H31O3P |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (1S,9S,10R,11R)-10-tert-butyl-1,9-diphenyl-11-propoxy-12-oxa-11-phosphatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CCCO[P@]1[C@H](C(C)(C)C)[C@@]2(c3ccccc3)O[C@]1(c1ccccc1)c1ccccc1C2=O |
| InChI | InChI=1S/C29H31O3P/c1-5-20-31-33-26(27(2,3)4)28(21-14-8-6-9-15-21)25(30)23-18-12-13-19-24(23)29(33,32-28)22-16-10-7-11-17-22/h6-19,26H,5,20H2,1-4H3/t26-,28+,29+,33-/m1/s1 |
| InChIKey | YHFINJWKXIOFDG-MAWOIFGPSA-N |
| XLogP | 7.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|