C26H23O2PS2 — CID 102008224
(1S,9S,10R)-10-tert-butyl-1,9-diphenyl-12-sulfanylidene-13-oxa-11-thia-12λ5-phosphatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one (PubChem CID 102008224) has the molecular formula C26H23O2PS2 and a molecular weight of 462.58 g/mol. Its IUPAC name is (1S,9S,10R)-10-tert-butyl-1,9-diphenyl-12-sulfanylidene-13-oxa-11-thia-12λ5-phosphatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10R)-10-tert-butyl-1,9-diphenyl-12-sulfanylidene-13-oxa-11-thia-12λ5-phosphatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 102008224 |
| Molecular Formula | C26H23O2PS2 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (1S,9S,10R)-10-tert-butyl-1,9-diphenyl-12-sulfanylidene-13-oxa-11-thia-12λ5-phosphatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one |
| SMILES | CC(C)(C)[C@]12SP1(=S)C1(c3ccccc3)O[C@@]2(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H23O2PS2/c1-23(2,3)26-24(18-12-6-4-7-13-18)22(27)20-16-10-11-17-21(20)25(28-24,29(26,30)31-26)19-14-8-5-9-15-19/h4-17H,1-3H3/t24-,25?,26+,29?/m0/s1 |
| InChIKey | IZISAHRCUZGPRQ-GQSIUWKSSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|