C16H10O4 — CID 98144684
(1aR,6aS)-6-oxo-6a-phenylindeno[1,2-b]oxirene-1a-carboxylic acid (PubChem CID 98144684) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is (1aR,6aS)-6-oxo-6a-phenylindeno[1,2-b]oxirene-1a-carboxylic acid.
| Compound Name | (1aR,6aS)-6-oxo-6a-phenylindeno[1,2-b]oxirene-1a-carboxylic acid |
|---|---|
| PubChem CID | 98144684 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (1aR,6aS)-6-oxo-6a-phenylindeno[1,2-b]oxirene-1a-carboxylic acid |
| SMILES | O=C(O)[C@]12O[C@]1(c1ccccc1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C16H10O4/c17-13-11-8-4-5-9-12(11)16(14(18)19)15(13,20-16)10-6-2-1-3-7-10/h1-9H,(H,18,19)/t15-,16+/m1/s1 |
| InChIKey | HCYAPSYWRHYDRK-CVEARBPZSA-N |
| XLogP | 2.09 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|