C21H18O5 — CID 7460050
ethyl (1aR,7aS)-7a-(4-ethylphenyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 7460050) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl (1aR,7aS)-7a-(4-ethylphenyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | ethyl (1aR,7aS)-7a-(4-ethylphenyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 7460050 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | ethyl (1aR,7aS)-7a-(4-ethylphenyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]1(c1ccc(CC)cc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H18O5/c1-3-13-9-11-14(12-10-13)20-17(22)15-7-5-6-8-16(15)18(23)21(20,26-20)19(24)25-4-2/h5-12H,3-4H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | PTOMMMVVCKNMMJ-NHCUHLMSSA-N |
| XLogP | 2.86 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|