C29H23NO — CID 98533218
(1S,8S,10S,11R)-10-methyl-1,8,11-triphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 98533218) has the molecular formula C29H23NO and a molecular weight of 401.51 g/mol. Its IUPAC name is (1S,8S,10S,11R)-10-methyl-1,8,11-triphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1S,8S,10S,11R)-10-methyl-1,8,11-triphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98533218 |
| Molecular Formula | C29H23NO |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (1S,8S,10S,11R)-10-methyl-1,8,11-triphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | C[C@@H]1N2[C@@]3(c4ccccc4)O[C@@](c4ccccc4)(c4ccccc43)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C29H23NO/c1-21-27(22-13-5-2-6-14-22)28(23-15-7-3-8-16-23)25-19-11-12-20-26(25)29(31-28,30(21)27)24-17-9-4-10-18-24/h2-21H,1H3/t21-,27-,28-,29-,30?/m0/s1 |
| InChIKey | MHVFAOMRYBUSQM-XPGUIZNYSA-N |
| XLogP | 5.77 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|