C41H30O — CID 98509228
(1S,8S,9R,11R)-1,8,9,10,11-pentakis-phenyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 98509228) has the molecular formula C41H30O and a molecular weight of 538.69 g/mol. Its IUPAC name is (1S,8S,9R,11R)-1,8,9,10,11-pentakis-phenyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1S,8S,9R,11R)-1,8,9,10,11-pentakis-phenyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98509228 |
| Molecular Formula | C41H30O |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (1S,8S,9R,11R)-1,8,9,10,11-pentakis-phenyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | c1ccc(C2[C@]3(c4ccccc4)[C@@]4(c5ccccc5)O[C@@](c5ccccc5)(c5ccccc54)[C@@]23c2ccccc2)cc1 |
| InChI | InChI=1S/C41H30O/c1-6-18-30(19-7-1)37-38(31-20-8-2-9-21-31)39(37,32-22-10-3-11-23-32)41(34-26-14-5-15-27-34)36-29-17-16-28-35(36)40(38,42-41)33-24-12-4-13-25-33/h1-29,37H/t38-,39-,40-,41-/m0/s1 |
| InChIKey | PJEZNBBGHIFYCK-MFDNGWNGSA-N |
| XLogP | 8.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |