C32H27N — CID 10741060
4-[(1S,8R,9S,11R)-10,10-dimethyl-8,11-diphenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]benzonitrile (PubChem CID 10741060) has the molecular formula C32H27N and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[(1S,8R,9S,11R)-10,10-dimethyl-8,11-diphenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]benzonitrile.
| Compound Name | 4-[(1S,8R,9S,11R)-10,10-dimethyl-8,11-diphenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]benzonitrile |
|---|---|
| PubChem CID | 10741060 |
| Molecular Formula | C32H27N |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[(1S,8R,9S,11R)-10,10-dimethyl-8,11-diphenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]benzonitrile |
| SMILES | CC1(C)[C@@H](c2ccc(C#N)cc2)[C@]2(c3ccccc3)c3ccccc3[C@H]1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C32H27N/c1-31(2)29-26-15-9-10-16-27(26)32(25-13-7-4-8-14-25,28(29)23-11-5-3-6-12-23)30(31)24-19-17-22(21-33)18-20-24/h3-20,28-30H,1-2H3/t28-,29-,30+,32+/m0/s1 |
| InChIKey | KBALZIXJSYBNNQ-YFZRJWSLSA-N |
| XLogP | 7.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |