C19H15NO — CID 101001916
4-[(1S,5S,6S)-4-oxo-1-phenyl-6-bicyclo[3.1.0]hexanyl]benzonitrile (PubChem CID 101001916) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[(1S,5S,6S)-4-oxo-1-phenyl-6-bicyclo[3.1.0]hexanyl]benzonitrile.
| Compound Name | 4-[(1S,5S,6S)-4-oxo-1-phenyl-6-bicyclo[3.1.0]hexanyl]benzonitrile |
|---|---|
| PubChem CID | 101001916 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-[(1S,5S,6S)-4-oxo-1-phenyl-6-bicyclo[3.1.0]hexanyl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2[C@@H]3C(=O)CC[C@]23c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15NO/c20-12-13-6-8-14(9-7-13)17-18-16(21)10-11-19(17,18)15-4-2-1-3-5-15/h1-9,17-18H,10-11H2/t17-,18+,19+/m1/s1 |
| InChIKey | NRCAEWKJQXCOOE-QYZOEREBSA-N |
| XLogP | 3.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |