C19H14N2OS — CID 122212230
4-[(2S,6S)-6-(4-cyanophenyl)-4-oxothian-2-yl]benzonitrile (PubChem CID 122212230) has the molecular formula C19H14N2OS and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-[(2S,6S)-6-(4-cyanophenyl)-4-oxothian-2-yl]benzonitrile.
| Compound Name | 4-[(2S,6S)-6-(4-cyanophenyl)-4-oxothian-2-yl]benzonitrile |
|---|---|
| PubChem CID | 122212230 |
| Molecular Formula | C19H14N2OS |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-[(2S,6S)-6-(4-cyanophenyl)-4-oxothian-2-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2CC(=O)C[C@@H](c3ccc(C#N)cc3)S2)cc1 |
| InChI | InChI=1S/C19H14N2OS/c20-11-13-1-5-15(6-2-13)18-9-17(22)10-19(23-18)16-7-3-14(12-21)4-8-16/h1-8,18-19H,9-10H2/t18-,19-/m0/s1 |
| InChIKey | XAXYOOSQCWOJJD-OALUTQOASA-N |
| XLogP | 4.31 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |