C23H16BrNO — CID 23583920
4-(1-bromo-4-oxo-2-phenyl-1,3-dihydronaphthalen-2-yl)benzonitrile (PubChem CID 23583920) has the molecular formula C23H16BrNO and a molecular weight of 402.29 g/mol. Its IUPAC name is 4-(1-bromo-4-oxo-2-phenyl-1,3-dihydronaphthalen-2-yl)benzonitrile.
| Compound Name | 4-(1-bromo-4-oxo-2-phenyl-1,3-dihydronaphthalen-2-yl)benzonitrile |
|---|---|
| PubChem CID | 23583920 |
| Molecular Formula | C23H16BrNO |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-(1-bromo-4-oxo-2-phenyl-1,3-dihydronaphthalen-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2(c3ccccc3)CC(=O)c3ccccc3C2Br)cc1 |
| InChI | InChI=1S/C23H16BrNO/c24-22-20-9-5-4-8-19(20)21(26)14-23(22,17-6-2-1-3-7-17)18-12-10-16(15-25)11-13-18/h1-13,22H,14H2 |
| InChIKey | LOVZDIHOYPZLDV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|