About cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile
cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile (PubChem CID 175860116) has the molecular formula C28H17N3O
and a molecular weight of 411.46 g/mol. Its IUPAC name is cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile.
Molecular Properties
| Compound Name | cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile |
| PubChem CID | 175860116 |
| Molecular Formula | C28H17N3O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile |
| SMILES | N#CO.N#Cc1ccc(C2(c3ccc(C#N)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C27H16N2.CHNO/c28-17-19-9-13-21(14-10-19)27(22-15-11-20(18-29)12-16-22)25-7-3-1-5-23(25)24-6-2-4-8-26(24)27;2-1-3/h1-16H;3H |
| InChIKey | VNARSGOZVMZJJL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile?
The IUPAC name of cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile (CID 175860116) is cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile.
What is the SMILES notation for cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile?
The canonical SMILES for cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile is N#CO.N#Cc1ccc(C2(c3ccc(C#N)cc3)c3ccccc3-c3ccccc32)cc1.
What is the InChIKey of cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile?
The InChIKey is VNARSGOZVMZJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16N2.CHNO/c28-17-19-9-13-21(14-10-19)27(22-15-11-20(18-29)12-16-22)25-7-3-1-5-23(25)24-6-2-4-8-26(24)27;2-1-3/h1-16H;3H.
What are the key properties of cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile?
cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile has a molecular weight of 411.46 g/mol, XLogP of 5.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;4-[9-(4-cyanophenyl)fluoren-9-yl]benzonitrile is sourced from PubChem (CID 175860116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).