C53H30N4 — CID 67472777
4-[3-[9-[3,5-bis(4-cyanophenyl)phenyl]fluoren-9-yl]-5-(4-cyanophenyl)phenyl]benzonitrile (PubChem CID 67472777) has the molecular formula C53H30N4 and a molecular weight of 722.85 g/mol. Its IUPAC name is 4-[3-[9-[3,5-bis(4-cyanophenyl)phenyl]fluoren-9-yl]-5-(4-cyanophenyl)phenyl]benzonitrile.
| Compound Name | 4-[3-[9-[3,5-bis(4-cyanophenyl)phenyl]fluoren-9-yl]-5-(4-cyanophenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 67472777 |
| Molecular Formula | C53H30N4 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 4-[3-[9-[3,5-bis(4-cyanophenyl)phenyl]fluoren-9-yl]-5-(4-cyanophenyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(C#N)cc3)cc(C3(c4cc(-c5ccc(C#N)cc5)cc(-c5ccc(C#N)cc5)c4)c4ccccc4-c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C53H30N4/c54-31-35-9-17-39(18-10-35)43-25-44(40-19-11-36(32-55)12-20-40)28-47(27-43)53(51-7-3-1-5-49(51)50-6-2-4-8-52(50)53)48-29-45(41-21-13-37(33-56)14-22-41)26-46(30-48)42-23-15-38(34-57)16-24-42/h1-30H |
| InChIKey | BWQBOUCCFATPQA-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |